C22H26F6N4O5Si — CID 90403331
3-methyl-8-[3-(trifluoromethoxy)phenoxy]-1-(3,3,3-trifluoropropyl)-7-(2-trimethylsilylethoxymethyl)purine-2,6-dione (PubChem CID 90403331) has the molecular formula C22H26F6N4O5Si and a molecular weight of 568.55 g/mol. Its IUPAC name is 3-methyl-8-[3-(trifluoromethoxy)phenoxy]-1-(3,3,3-trifluoropropyl)-7-(2-trimethylsilylethoxymethyl)purine-2,6-dione.
| Compound Name | 3-methyl-8-[3-(trifluoromethoxy)phenoxy]-1-(3,3,3-trifluoropropyl)-7-(2-trimethylsilylethoxymethyl)purine-2,6-dione |
|---|---|
| PubChem CID | 90403331 |
| Molecular Formula | C22H26F6N4O5Si |
| Molecular Weight | 568.55 g/mol |
| Exact Mass | 568.16 |
| IUPAC Name | 3-methyl-8-[3-(trifluoromethoxy)phenoxy]-1-(3,3,3-trifluoropropyl)-7-(2-trimethylsilylethoxymethyl)purine-2,6-dione |
| SMILES | Cn1c(=O)n(CCC(F)(F)F)c(=O)c2c1nc(Oc1cccc(OC(F)(F)F)c1)n2COCC[Si](C)(C)C |
| InChI | InChI=1S/C22H26F6N4O5Si/c1-30-17-16(18(33)31(20(30)34)9-8-21(23,24)25)32(13-35-10-11-38(2,3)4)19(29-17)36-14-6-5-7-15(12-14)37-22(26,27)28/h5-7,12H,8-11,13H2,1-4H3 |
| InChIKey | XEONQQZVVDBWRY-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 89.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.55 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|