About [3-(6-bromo-1H-imidazo[4,5-b]pyridin-2-yl)-4-chlorophenyl]carbamic acid
[3-(6-bromo-1H-imidazo[4,5-b]pyridin-2-yl)-4-chlorophenyl]carbamic acid (PubChem CID 90403447) has the molecular formula C13H8BrClN4O2
and a molecular weight of 367.59 g/mol. Its IUPAC name is [3-(6-bromo-1H-imidazo[4,5-b]pyridin-2-yl)-4-chlorophenyl]carbamic acid.
Molecular Properties
| Compound Name | [3-(6-bromo-1H-imidazo[4,5-b]pyridin-2-yl)-4-chlorophenyl]carbamic acid |
| PubChem CID | 90403447 |
| Molecular Formula | C13H8BrClN4O2 |
| Molecular Weight | 367.59 g/mol |
| Exact Mass | 365.95 |
| IUPAC Name | [3-(6-bromo-1H-imidazo[4,5-b]pyridin-2-yl)-4-chlorophenyl]carbamic acid |
| SMILES | O=C(O)Nc1ccc(Cl)c(-c2nc3ncc(Br)cc3[nH]2)c1 |
| InChI | InChI=1S/C13H8BrClN4O2/c14-6-3-10-12(16-5-6)19-11(18-10)8-4-7(17-13(20)21)1-2-9(8)15/h1-5,17H,(H,20,21)(H,16,18,19) |
| InChIKey | IDSRYVNPWVSYQD-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 367.59 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [3-(6-bromo-1H-imidazo[4,5-b]pyridin-2-yl)-4-chlorophenyl]carbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(6-bromo-1H-imidazo[4,5-b]pyridin-2-yl)-4-chlorophenyl]carbamic acid?
The IUPAC name of [3-(6-bromo-1H-imidazo[4,5-b]pyridin-2-yl)-4-chlorophenyl]carbamic acid (CID 90403447) is [3-(6-bromo-1H-imidazo[4,5-b]pyridin-2-yl)-4-chlorophenyl]carbamic acid.
What is the SMILES notation for [3-(6-bromo-1H-imidazo[4,5-b]pyridin-2-yl)-4-chlorophenyl]carbamic acid?
The canonical SMILES for [3-(6-bromo-1H-imidazo[4,5-b]pyridin-2-yl)-4-chlorophenyl]carbamic acid is O=C(O)Nc1ccc(Cl)c(-c2nc3ncc(Br)cc3[nH]2)c1.
What is the InChIKey of [3-(6-bromo-1H-imidazo[4,5-b]pyridin-2-yl)-4-chlorophenyl]carbamic acid?
The InChIKey is IDSRYVNPWVSYQD-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H8BrClN4O2/c14-6-3-10-12(16-5-6)19-11(18-10)8-4-7(17-13(20)21)1-2-9(8)15/h1-5,17H,(H,20,21)(H,16,18,19).
What are the key properties of [3-(6-bromo-1H-imidazo[4,5-b]pyridin-2-yl)-4-chlorophenyl]carbamic acid?
[3-(6-bromo-1H-imidazo[4,5-b]pyridin-2-yl)-4-chlorophenyl]carbamic acid has a molecular weight of 367.59 g/mol, XLogP of 4.13, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(6-bromo-1H-imidazo[4,5-b]pyridin-2-yl)-4-chlorophenyl]carbamic acid is sourced from PubChem (CID 90403447), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).