C20H25F3N4O5Si — CID 90403683
1,3-dimethyl-8-[3-(trifluoromethoxy)phenoxy]-7-(2-trimethylsilylethoxymethyl)purine-2,6-dione (PubChem CID 90403683) has the molecular formula C20H25F3N4O5Si and a molecular weight of 486.52 g/mol. Its IUPAC name is 1,3-dimethyl-8-[3-(trifluoromethoxy)phenoxy]-7-(2-trimethylsilylethoxymethyl)purine-2,6-dione.
| Compound Name | 1,3-dimethyl-8-[3-(trifluoromethoxy)phenoxy]-7-(2-trimethylsilylethoxymethyl)purine-2,6-dione |
|---|---|
| PubChem CID | 90403683 |
| Molecular Formula | C20H25F3N4O5Si |
| Molecular Weight | 486.52 g/mol |
| Exact Mass | 486.15 |
| IUPAC Name | 1,3-dimethyl-8-[3-(trifluoromethoxy)phenoxy]-7-(2-trimethylsilylethoxymethyl)purine-2,6-dione |
| SMILES | Cn1c(=O)c2c(nc(Oc3cccc(OC(F)(F)F)c3)n2COCC[Si](C)(C)C)n(C)c1=O |
| InChI | InChI=1S/C20H25F3N4O5Si/c1-25-16-15(17(28)26(2)19(25)29)27(12-30-9-10-33(3,4)5)18(24-16)31-13-7-6-8-14(11-13)32-20(21,22)23/h6-8,11H,9-10,12H2,1-5H3 |
| InChIKey | BMFMOBFETKUCMO-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 89.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.52 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|