About methyl 4-amino-3,6-dichloro-5-iodopyridine-2-carboxylate
methyl 4-amino-3,6-dichloro-5-iodopyridine-2-carboxylate (PubChem CID 90403719) has the molecular formula C7H5Cl2IN2O2
and a molecular weight of 346.94 g/mol. Its IUPAC name is methyl 4-amino-3,6-dichloro-5-iodopyridine-2-carboxylate.
Molecular Properties
| Compound Name | methyl 4-amino-3,6-dichloro-5-iodopyridine-2-carboxylate |
| PubChem CID | 90403719 |
| Molecular Formula | C7H5Cl2IN2O2 |
| Molecular Weight | 346.94 g/mol |
| Exact Mass | 345.88 |
| IUPAC Name | methyl 4-amino-3,6-dichloro-5-iodopyridine-2-carboxylate |
| SMILES | COC(=O)c1nc(Cl)c(I)c(N)c1Cl |
| InChI | InChI=1S/C7H5Cl2IN2O2/c1-14-7(13)5-2(8)4(11)3(10)6(9)12-5/h1H3,(H2,11,12) |
| InChIKey | HNVKGYSSRCIGCA-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 346.94 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze methyl 4-amino-3,6-dichloro-5-iodopyridine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-amino-3,6-dichloro-5-iodopyridine-2-carboxylate?
The IUPAC name of methyl 4-amino-3,6-dichloro-5-iodopyridine-2-carboxylate (CID 90403719) is methyl 4-amino-3,6-dichloro-5-iodopyridine-2-carboxylate.
What is the SMILES notation for methyl 4-amino-3,6-dichloro-5-iodopyridine-2-carboxylate?
The canonical SMILES for methyl 4-amino-3,6-dichloro-5-iodopyridine-2-carboxylate is COC(=O)c1nc(Cl)c(I)c(N)c1Cl.
What is the InChIKey of methyl 4-amino-3,6-dichloro-5-iodopyridine-2-carboxylate?
The InChIKey is HNVKGYSSRCIGCA-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5Cl2IN2O2/c1-14-7(13)5-2(8)4(11)3(10)6(9)12-5/h1H3,(H2,11,12).
What are the key properties of methyl 4-amino-3,6-dichloro-5-iodopyridine-2-carboxylate?
methyl 4-amino-3,6-dichloro-5-iodopyridine-2-carboxylate has a molecular weight of 346.94 g/mol, XLogP of 2.36, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-amino-3,6-dichloro-5-iodopyridine-2-carboxylate is sourced from PubChem (CID 90403719), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).