C19H24F4N4O2S — CID 90404278
(3R,4S)-4-(4-fluorophenyl)-1-(1-methylimidazol-4-yl)sulfonyl-N-(5,5,5-trifluoropentyl)pyrrolidin-3-amine (PubChem CID 90404278) has the molecular formula C19H24F4N4O2S and a molecular weight of 448.49 g/mol. Its IUPAC name is (3R,4S)-4-(4-fluorophenyl)-1-(1-methylimidazol-4-yl)sulfonyl-N-(5,5,5-trifluoropentyl)pyrrolidin-3-amine.
| Compound Name | (3R,4S)-4-(4-fluorophenyl)-1-(1-methylimidazol-4-yl)sulfonyl-N-(5,5,5-trifluoropentyl)pyrrolidin-3-amine |
|---|---|
| PubChem CID | 90404278 |
| Molecular Formula | C19H24F4N4O2S |
| Molecular Weight | 448.49 g/mol |
| Exact Mass | 448.16 |
| IUPAC Name | (3R,4S)-4-(4-fluorophenyl)-1-(1-methylimidazol-4-yl)sulfonyl-N-(5,5,5-trifluoropentyl)pyrrolidin-3-amine |
| SMILES | Cn1cnc(S(=O)(=O)N2C[C@H](NCCCCC(F)(F)F)[C@@H](c3ccc(F)cc3)C2)c1 |
| InChI | InChI=1S/C19H24F4N4O2S/c1-26-12-18(25-13-26)30(28,29)27-10-16(14-4-6-15(20)7-5-14)17(11-27)24-9-3-2-8-19(21,22)23/h4-7,12-13,16-17,24H,2-3,8-11H2,1H3/t16-,17+/m1/s1 |
| InChIKey | RSHVQNPDIVBDHS-SJORKVTESA-N |
| XLogP | 3.04 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.49 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|