C20H18F4N4O2S — CID 90404589
(3S,4R)-4-(4-fluorophenyl)-1-(1-methylimidazol-4-yl)sulfonyl-N-(2,3,4-trifluorophenyl)pyrrolidin-3-amine (PubChem CID 90404589) has the molecular formula C20H18F4N4O2S and a molecular weight of 454.45 g/mol. Its IUPAC name is (3S,4R)-4-(4-fluorophenyl)-1-(1-methylimidazol-4-yl)sulfonyl-N-(2,3,4-trifluorophenyl)pyrrolidin-3-amine.
| Compound Name | (3S,4R)-4-(4-fluorophenyl)-1-(1-methylimidazol-4-yl)sulfonyl-N-(2,3,4-trifluorophenyl)pyrrolidin-3-amine |
|---|---|
| PubChem CID | 90404589 |
| Molecular Formula | C20H18F4N4O2S |
| Molecular Weight | 454.45 g/mol |
| Exact Mass | 454.11 |
| IUPAC Name | (3S,4R)-4-(4-fluorophenyl)-1-(1-methylimidazol-4-yl)sulfonyl-N-(2,3,4-trifluorophenyl)pyrrolidin-3-amine |
| SMILES | Cn1cnc(S(=O)(=O)N2C[C@@H](Nc3ccc(F)c(F)c3F)[C@H](c3ccc(F)cc3)C2)c1 |
| InChI | InChI=1S/C20H18F4N4O2S/c1-27-10-18(25-11-27)31(29,30)28-8-14(12-2-4-13(21)5-3-12)17(9-28)26-16-7-6-15(22)19(23)20(16)24/h2-7,10-11,14,17,26H,8-9H2,1H3/t14-,17+/m0/s1 |
| InChIKey | KZFOBGBXUHTIDV-WMLDXEAASA-N |
| XLogP | 3.25 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.45 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|