About 3-[4-(2-isocyanatoethyl)phenyl]-1-[4-(trifluoromethyl)phenyl]-1,2,4-triazole;propanoyl azide
3-[4-(2-isocyanatoethyl)phenyl]-1-[4-(trifluoromethyl)phenyl]-1,2,4-triazole;propanoyl azide (PubChem CID 90404968) has the molecular formula C21H18F3N7O2
and a molecular weight of 457.42 g/mol. Its IUPAC name is 3-[4-(2-isocyanatoethyl)phenyl]-1-[4-(trifluoromethyl)phenyl]-1,2,4-triazole;propanoyl azide.
Molecular Properties
| Compound Name | 3-[4-(2-isocyanatoethyl)phenyl]-1-[4-(trifluoromethyl)phenyl]-1,2,4-triazole;propanoyl azide |
| PubChem CID | 90404968 |
| Molecular Formula | C21H18F3N7O2 |
| Molecular Weight | 457.42 g/mol |
| Exact Mass | 457.15 |
| IUPAC Name | 3-[4-(2-isocyanatoethyl)phenyl]-1-[4-(trifluoromethyl)phenyl]-1,2,4-triazole;propanoyl azide |
| SMILES | CCC(=O)N=[N+]=[N-].O=C=NCCc1ccc(-c2ncn(-c3ccc(C(F)(F)F)cc3)n2)cc1 |
| InChI | InChI=1S/C18H13F3N4O.C3H5N3O/c19-18(20,21)15-5-7-16(8-6-15)25-11-23-17(24-25)14-3-1-13(2-4-14)9-10-22-12-26;1-2-3(7)5-6-4/h1-8,11H,9-10H2;2H2,1H3 |
| InChIKey | NPJYCJDGZLORIG-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 125.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 457.42 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|
Analyze 3-[4-(2-isocyanatoethyl)phenyl]-1-[4-(trifluoromethyl)phenyl]-1,2,4-triazole;propanoyl azide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[4-(2-isocyanatoethyl)phenyl]-1-[4-(trifluoromethyl)phenyl]-1,2,4-triazole;propanoyl azide?
The IUPAC name of 3-[4-(2-isocyanatoethyl)phenyl]-1-[4-(trifluoromethyl)phenyl]-1,2,4-triazole;propanoyl azide (CID 90404968) is 3-[4-(2-isocyanatoethyl)phenyl]-1-[4-(trifluoromethyl)phenyl]-1,2,4-triazole;propanoyl azide.
What is the SMILES notation for 3-[4-(2-isocyanatoethyl)phenyl]-1-[4-(trifluoromethyl)phenyl]-1,2,4-triazole;propanoyl azide?
The canonical SMILES for 3-[4-(2-isocyanatoethyl)phenyl]-1-[4-(trifluoromethyl)phenyl]-1,2,4-triazole;propanoyl azide is CCC(=O)N=[N+]=[N-].O=C=NCCc1ccc(-c2ncn(-c3ccc(C(F)(F)F)cc3)n2)cc1.
What is the InChIKey of 3-[4-(2-isocyanatoethyl)phenyl]-1-[4-(trifluoromethyl)phenyl]-1,2,4-triazole;propanoyl azide?
The InChIKey is NPJYCJDGZLORIG-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H13F3N4O.C3H5N3O/c19-18(20,21)15-5-7-16(8-6-15)25-11-23-17(24-25)14-3-1-13(2-4-14)9-10-22-12-26;1-2-3(7)5-6-4/h1-8,11H,9-10H2;2H2,1H3.
What are the key properties of 3-[4-(2-isocyanatoethyl)phenyl]-1-[4-(trifluoromethyl)phenyl]-1,2,4-triazole;propanoyl azide?
3-[4-(2-isocyanatoethyl)phenyl]-1-[4-(trifluoromethyl)phenyl]-1,2,4-triazole;propanoyl azide has a molecular weight of 457.42 g/mol, XLogP of 5.06, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[4-(2-isocyanatoethyl)phenyl]-1-[4-(trifluoromethyl)phenyl]-1,2,4-triazole;propanoyl azide is sourced from PubChem (CID 90404968), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).