C25H29FN4O3S — CID 90405038
(3R,4S)-N-(4,4-dimethyl-2,3-dihydrochromen-6-yl)-4-(4-fluorophenyl)-1-(1-methylimidazol-4-yl)sulfonylpyrrolidin-3-amine (PubChem CID 90405038) has the molecular formula C25H29FN4O3S and a molecular weight of 484.60 g/mol. Its IUPAC name is (3R,4S)-N-(4,4-dimethyl-2,3-dihydrochromen-6-yl)-4-(4-fluorophenyl)-1-(1-methylimidazol-4-yl)sulfonylpyrrolidin-3-amine.
| Compound Name | (3R,4S)-N-(4,4-dimethyl-2,3-dihydrochromen-6-yl)-4-(4-fluorophenyl)-1-(1-methylimidazol-4-yl)sulfonylpyrrolidin-3-amine |
|---|---|
| PubChem CID | 90405038 |
| Molecular Formula | C25H29FN4O3S |
| Molecular Weight | 484.60 g/mol |
| Exact Mass | 484.19 |
| IUPAC Name | (3R,4S)-N-(4,4-dimethyl-2,3-dihydrochromen-6-yl)-4-(4-fluorophenyl)-1-(1-methylimidazol-4-yl)sulfonylpyrrolidin-3-amine |
| SMILES | Cn1cnc(S(=O)(=O)N2C[C@H](Nc3ccc4c(c3)C(C)(C)CCO4)[C@@H](c3ccc(F)cc3)C2)c1 |
| InChI | InChI=1S/C25H29FN4O3S/c1-25(2)10-11-33-23-9-8-19(12-21(23)25)28-22-14-30(34(31,32)24-15-29(3)16-27-24)13-20(22)17-4-6-18(26)7-5-17/h4-9,12,15-16,20,22,28H,10-11,13-14H2,1-3H3/t20-,22+/m1/s1 |
| InChIKey | LXHSMMVKCAOBJX-IRLDBZIGSA-N |
| XLogP | 3.89 |
| TPSA | 76.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.60 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|