About N-(3,4-difluorophenyl)-1-(2,5-dimethylfuran-3-yl)sulfonyl-4-phenylpyrrolidin-3-amine
N-(3,4-difluorophenyl)-1-(2,5-dimethylfuran-3-yl)sulfonyl-4-phenylpyrrolidin-3-amine (PubChem CID 90405107) has the molecular formula C22H22F2N2O3S
and a molecular weight of 432.49 g/mol. Its IUPAC name is N-(3,4-difluorophenyl)-1-(2,5-dimethylfuran-3-yl)sulfonyl-4-phenylpyrrolidin-3-amine.
Molecular Properties
| Compound Name | N-(3,4-difluorophenyl)-1-(2,5-dimethylfuran-3-yl)sulfonyl-4-phenylpyrrolidin-3-amine |
| PubChem CID | 90405107 |
| Molecular Formula | C22H22F2N2O3S |
| Molecular Weight | 432.49 g/mol |
| Exact Mass | 432.13 |
| IUPAC Name | N-(3,4-difluorophenyl)-1-(2,5-dimethylfuran-3-yl)sulfonyl-4-phenylpyrrolidin-3-amine |
| SMILES | Cc1cc(S(=O)(=O)N2CC(Nc3ccc(F)c(F)c3)C(c3ccccc3)C2)c(C)o1 |
| InChI | InChI=1S/C22H22F2N2O3S/c1-14-10-22(15(2)29-14)30(27,28)26-12-18(16-6-4-3-5-7-16)21(13-26)25-17-8-9-19(23)20(24)11-17/h3-11,18,21,25H,12-13H2,1-2H3 |
| InChIKey | GMJGYKRNGLJOKS-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 62.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 432.49 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(3,4-difluorophenyl)-1-(2,5-dimethylfuran-3-yl)sulfonyl-4-phenylpyrrolidin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3,4-difluorophenyl)-1-(2,5-dimethylfuran-3-yl)sulfonyl-4-phenylpyrrolidin-3-amine?
The IUPAC name of N-(3,4-difluorophenyl)-1-(2,5-dimethylfuran-3-yl)sulfonyl-4-phenylpyrrolidin-3-amine (CID 90405107) is N-(3,4-difluorophenyl)-1-(2,5-dimethylfuran-3-yl)sulfonyl-4-phenylpyrrolidin-3-amine.
What is the SMILES notation for N-(3,4-difluorophenyl)-1-(2,5-dimethylfuran-3-yl)sulfonyl-4-phenylpyrrolidin-3-amine?
The canonical SMILES for N-(3,4-difluorophenyl)-1-(2,5-dimethylfuran-3-yl)sulfonyl-4-phenylpyrrolidin-3-amine is Cc1cc(S(=O)(=O)N2CC(Nc3ccc(F)c(F)c3)C(c3ccccc3)C2)c(C)o1.
What is the InChIKey of N-(3,4-difluorophenyl)-1-(2,5-dimethylfuran-3-yl)sulfonyl-4-phenylpyrrolidin-3-amine?
The InChIKey is GMJGYKRNGLJOKS-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H22F2N2O3S/c1-14-10-22(15(2)29-14)30(27,28)26-12-18(16-6-4-3-5-7-16)21(13-26)25-17-8-9-19(23)20(24)11-17/h3-11,18,21,25H,12-13H2,1-2H3.
What are the key properties of N-(3,4-difluorophenyl)-1-(2,5-dimethylfuran-3-yl)sulfonyl-4-phenylpyrrolidin-3-amine?
N-(3,4-difluorophenyl)-1-(2,5-dimethylfuran-3-yl)sulfonyl-4-phenylpyrrolidin-3-amine has a molecular weight of 432.49 g/mol, XLogP of 4.44, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3,4-difluorophenyl)-1-(2,5-dimethylfuran-3-yl)sulfonyl-4-phenylpyrrolidin-3-amine is sourced from PubChem (CID 90405107), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).