C24H20F2N4O4S — CID 90405123
6-[3-(3,4-difluoroanilino)-4-phenylpyrrolidin-1-yl]sulfonyl-1,4-dihydroquinoxaline-2,3-dione (PubChem CID 90405123) has the molecular formula C24H20F2N4O4S and a molecular weight of 498.51 g/mol. Its IUPAC name is 6-[3-(3,4-difluoroanilino)-4-phenylpyrrolidin-1-yl]sulfonyl-1,4-dihydroquinoxaline-2,3-dione.
| Compound Name | 6-[3-(3,4-difluoroanilino)-4-phenylpyrrolidin-1-yl]sulfonyl-1,4-dihydroquinoxaline-2,3-dione |
|---|---|
| PubChem CID | 90405123 |
| Molecular Formula | C24H20F2N4O4S |
| Molecular Weight | 498.51 g/mol |
| Exact Mass | 498.12 |
| IUPAC Name | 6-[3-(3,4-difluoroanilino)-4-phenylpyrrolidin-1-yl]sulfonyl-1,4-dihydroquinoxaline-2,3-dione |
| SMILES | O=c1[nH]c2ccc(S(=O)(=O)N3CC(Nc4ccc(F)c(F)c4)C(c4ccccc4)C3)cc2[nH]c1=O |
| InChI | InChI=1S/C24H20F2N4O4S/c25-18-8-6-15(10-19(18)26)27-22-13-30(12-17(22)14-4-2-1-3-5-14)35(33,34)16-7-9-20-21(11-16)29-24(32)23(31)28-20/h1-11,17,22,27H,12-13H2,(H,28,31)(H,29,32) |
| InChIKey | IYQIHDHRRNAFFP-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 115.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.51 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|