C20H19F3N4O2S — CID 90405193
(3S,4R)-1-(1-methylimidazol-4-yl)sulfonyl-4-phenyl-N-(2,3,4-trifluorophenyl)pyrrolidin-3-amine (PubChem CID 90405193) has the molecular formula C20H19F3N4O2S and a molecular weight of 436.46 g/mol. Its IUPAC name is (3S,4R)-1-(1-methylimidazol-4-yl)sulfonyl-4-phenyl-N-(2,3,4-trifluorophenyl)pyrrolidin-3-amine.
| Compound Name | (3S,4R)-1-(1-methylimidazol-4-yl)sulfonyl-4-phenyl-N-(2,3,4-trifluorophenyl)pyrrolidin-3-amine |
|---|---|
| PubChem CID | 90405193 |
| Molecular Formula | C20H19F3N4O2S |
| Molecular Weight | 436.46 g/mol |
| Exact Mass | 436.12 |
| IUPAC Name | (3S,4R)-1-(1-methylimidazol-4-yl)sulfonyl-4-phenyl-N-(2,3,4-trifluorophenyl)pyrrolidin-3-amine |
| SMILES | Cn1cnc(S(=O)(=O)N2C[C@@H](Nc3ccc(F)c(F)c3F)[C@H](c3ccccc3)C2)c1 |
| InChI | InChI=1S/C20H19F3N4O2S/c1-26-11-18(24-12-26)30(28,29)27-9-14(13-5-3-2-4-6-13)17(10-27)25-16-8-7-15(21)19(22)20(16)23/h2-8,11-12,14,17,25H,9-10H2,1H3/t14-,17+/m0/s1 |
| InChIKey | LITDWIDTCFXJKJ-WMLDXEAASA-N |
| XLogP | 3.11 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.46 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|