C18H23F3N4O2S — CID 90405558
(3R,4S)-1-(1-methylimidazol-4-yl)sulfonyl-4-phenyl-N-(4,4,4-trifluorobutyl)pyrrolidin-3-amine (PubChem CID 90405558) has the molecular formula C18H23F3N4O2S and a molecular weight of 416.47 g/mol. Its IUPAC name is (3R,4S)-1-(1-methylimidazol-4-yl)sulfonyl-4-phenyl-N-(4,4,4-trifluorobutyl)pyrrolidin-3-amine.
| Compound Name | (3R,4S)-1-(1-methylimidazol-4-yl)sulfonyl-4-phenyl-N-(4,4,4-trifluorobutyl)pyrrolidin-3-amine |
|---|---|
| PubChem CID | 90405558 |
| Molecular Formula | C18H23F3N4O2S |
| Molecular Weight | 416.47 g/mol |
| Exact Mass | 416.15 |
| IUPAC Name | (3R,4S)-1-(1-methylimidazol-4-yl)sulfonyl-4-phenyl-N-(4,4,4-trifluorobutyl)pyrrolidin-3-amine |
| SMILES | Cn1cnc(S(=O)(=O)N2C[C@H](NCCCC(F)(F)F)[C@@H](c3ccccc3)C2)c1 |
| InChI | InChI=1S/C18H23F3N4O2S/c1-24-12-17(23-13-24)28(26,27)25-10-15(14-6-3-2-4-7-14)16(11-25)22-9-5-8-18(19,20)21/h2-4,6-7,12-13,15-16,22H,5,8-11H2,1H3/t15-,16+/m1/s1 |
| InChIKey | MUHSBXJAQIPQEB-CVEARBPZSA-N |
| XLogP | 2.51 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.47 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|