C16H22ClN3O2 — CID 9040584
2-[(4-chlorophenyl)methyl-methylamino]-N-(cyclopentylcarbamoyl)acetamide (PubChem CID 9040584) has the molecular formula C16H22ClN3O2 and a molecular weight of 323.82 g/mol. Its IUPAC name is 2-[(4-chlorophenyl)methyl-methylamino]-N-(cyclopentylcarbamoyl)acetamide.
| Compound Name | 2-[(4-chlorophenyl)methyl-methylamino]-N-(cyclopentylcarbamoyl)acetamide |
|---|---|
| PubChem CID | 9040584 |
| Molecular Formula | C16H22ClN3O2 |
| Molecular Weight | 323.82 g/mol |
| Exact Mass | 323.14 |
| IUPAC Name | 2-[(4-chlorophenyl)methyl-methylamino]-N-(cyclopentylcarbamoyl)acetamide |
| SMILES | CN(CC(=O)NC(=O)NC1CCCC1)Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H22ClN3O2/c1-20(10-12-6-8-13(17)9-7-12)11-15(21)19-16(22)18-14-4-2-3-5-14/h6-9,14H,2-5,10-11H2,1H3,(H2,18,19,21,22) |
| InChIKey | XLIBBHLNXCVYKK-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.82 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |