C20H21ClFN5O2S — CID 90406638
(3R,4S)-N-[(2-chloro-3-fluoro-4-pyridinyl)methyl]-1-(1-methylimidazol-4-yl)sulfonyl-4-phenylpyrrolidin-3-amine (PubChem CID 90406638) has the molecular formula C20H21ClFN5O2S and a molecular weight of 449.94 g/mol. Its IUPAC name is (3R,4S)-N-[(2-chloro-3-fluoro-4-pyridinyl)methyl]-1-(1-methylimidazol-4-yl)sulfonyl-4-phenylpyrrolidin-3-amine.
| Compound Name | (3R,4S)-N-[(2-chloro-3-fluoro-4-pyridinyl)methyl]-1-(1-methylimidazol-4-yl)sulfonyl-4-phenylpyrrolidin-3-amine |
|---|---|
| PubChem CID | 90406638 |
| Molecular Formula | C20H21ClFN5O2S |
| Molecular Weight | 449.94 g/mol |
| Exact Mass | 449.11 |
| IUPAC Name | (3R,4S)-N-[(2-chloro-3-fluoro-4-pyridinyl)methyl]-1-(1-methylimidazol-4-yl)sulfonyl-4-phenylpyrrolidin-3-amine |
| SMILES | Cn1cnc(S(=O)(=O)N2C[C@H](NCc3ccnc(Cl)c3F)[C@@H](c3ccccc3)C2)c1 |
| InChI | InChI=1S/C20H21ClFN5O2S/c1-26-12-18(25-13-26)30(28,29)27-10-16(14-5-3-2-4-6-14)17(11-27)24-9-15-7-8-23-20(21)19(15)22/h2-8,12-13,16-17,24H,9-11H2,1H3/t16-,17+/m1/s1 |
| InChIKey | OZFYXQFSQDPWOS-SJORKVTESA-N |
| XLogP | 2.55 |
| TPSA | 80.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.94 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|