C19H22ClF3N4O2S — CID 90406701
1-[[2-chloro-4-(trifluoromethyl)phenyl]methyl]-6-(1-methylimidazol-4-yl)sulfonyl-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridine (PubChem CID 90406701) has the molecular formula C19H22ClF3N4O2S and a molecular weight of 462.93 g/mol. Its IUPAC name is 1-[[2-chloro-4-(trifluoromethyl)phenyl]methyl]-6-(1-methylimidazol-4-yl)sulfonyl-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridine.
| Compound Name | 1-[[2-chloro-4-(trifluoromethyl)phenyl]methyl]-6-(1-methylimidazol-4-yl)sulfonyl-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridine |
|---|---|
| PubChem CID | 90406701 |
| Molecular Formula | C19H22ClF3N4O2S |
| Molecular Weight | 462.93 g/mol |
| Exact Mass | 462.11 |
| IUPAC Name | 1-[[2-chloro-4-(trifluoromethyl)phenyl]methyl]-6-(1-methylimidazol-4-yl)sulfonyl-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridine |
| SMILES | Cn1cnc(S(=O)(=O)N2CC3CCCN(Cc4ccc(C(F)(F)F)cc4Cl)C3C2)c1 |
| InChI | InChI=1S/C19H22ClF3N4O2S/c1-25-11-18(24-12-25)30(28,29)27-9-14-3-2-6-26(17(14)10-27)8-13-4-5-15(7-16(13)20)19(21,22)23/h4-5,7,11-12,14,17H,2-3,6,8-10H2,1H3 |
| InChIKey | UBCXMVSJZGFVAI-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 58.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.93 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |