About 4-butyl-1-[(3S,4R)-4-phenylpyrrolidin-3-yl]triazole
4-butyl-1-[(3S,4R)-4-phenylpyrrolidin-3-yl]triazole (PubChem CID 90406891) has the molecular formula C16H22N4
and a molecular weight of 270.38 g/mol. Its IUPAC name is 4-butyl-1-[(3S,4R)-4-phenylpyrrolidin-3-yl]triazole.
Molecular Properties
| Compound Name | 4-butyl-1-[(3S,4R)-4-phenylpyrrolidin-3-yl]triazole |
| PubChem CID | 90406891 |
| Molecular Formula | C16H22N4 |
| Molecular Weight | 270.38 g/mol |
| Exact Mass | 270.18 |
| IUPAC Name | 4-butyl-1-[(3S,4R)-4-phenylpyrrolidin-3-yl]triazole |
| SMILES | CCCCc1cn([C@@H]2CNC[C@H]2c2ccccc2)nn1 |
| InChI | InChI=1S/C16H22N4/c1-2-3-9-14-12-20(19-18-14)16-11-17-10-15(16)13-7-5-4-6-8-13/h4-8,12,15-17H,2-3,9-11H2,1H3/t15-,16+/m0/s1 |
| InChIKey | OYKSGEVDMJNVHR-JKSUJKDBSA-N |
| XLogP | 2.55 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.38 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-butyl-1-[(3S,4R)-4-phenylpyrrolidin-3-yl]triazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-butyl-1-[(3S,4R)-4-phenylpyrrolidin-3-yl]triazole?
The IUPAC name of 4-butyl-1-[(3S,4R)-4-phenylpyrrolidin-3-yl]triazole (CID 90406891) is 4-butyl-1-[(3S,4R)-4-phenylpyrrolidin-3-yl]triazole.
What is the SMILES notation for 4-butyl-1-[(3S,4R)-4-phenylpyrrolidin-3-yl]triazole?
The canonical SMILES for 4-butyl-1-[(3S,4R)-4-phenylpyrrolidin-3-yl]triazole is CCCCc1cn([C@@H]2CNC[C@H]2c2ccccc2)nn1.
What is the InChIKey of 4-butyl-1-[(3S,4R)-4-phenylpyrrolidin-3-yl]triazole?
The InChIKey is OYKSGEVDMJNVHR-JKSUJKDBSA-N. The full InChI is InChI=1S/C16H22N4/c1-2-3-9-14-12-20(19-18-14)16-11-17-10-15(16)13-7-5-4-6-8-13/h4-8,12,15-17H,2-3,9-11H2,1H3/t15-,16+/m0/s1.
What are the key properties of 4-butyl-1-[(3S,4R)-4-phenylpyrrolidin-3-yl]triazole?
4-butyl-1-[(3S,4R)-4-phenylpyrrolidin-3-yl]triazole has a molecular weight of 270.38 g/mol, XLogP of 2.55, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-butyl-1-[(3S,4R)-4-phenylpyrrolidin-3-yl]triazole is sourced from PubChem (CID 90406891), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).