C22H23N5O3S — CID 90407118
2-methoxy-5-[[(3S,4R)-1-(1-methylimidazol-4-yl)sulfonyl-4-phenylpyrrolidin-3-yl]amino]benzonitrile (PubChem CID 90407118) has the molecular formula C22H23N5O3S and a molecular weight of 437.53 g/mol. Its IUPAC name is 2-methoxy-5-[[(3S,4R)-1-(1-methylimidazol-4-yl)sulfonyl-4-phenylpyrrolidin-3-yl]amino]benzonitrile.
| Compound Name | 2-methoxy-5-[[(3S,4R)-1-(1-methylimidazol-4-yl)sulfonyl-4-phenylpyrrolidin-3-yl]amino]benzonitrile |
|---|---|
| PubChem CID | 90407118 |
| Molecular Formula | C22H23N5O3S |
| Molecular Weight | 437.53 g/mol |
| Exact Mass | 437.15 |
| IUPAC Name | 2-methoxy-5-[[(3S,4R)-1-(1-methylimidazol-4-yl)sulfonyl-4-phenylpyrrolidin-3-yl]amino]benzonitrile |
| SMILES | COc1ccc(N[C@@H]2CN(S(=O)(=O)c3cn(C)cn3)C[C@H]2c2ccccc2)cc1C#N |
| InChI | InChI=1S/C22H23N5O3S/c1-26-14-22(24-15-26)31(28,29)27-12-19(16-6-4-3-5-7-16)20(13-27)25-18-8-9-21(30-2)17(10-18)11-23/h3-10,14-15,19-20,25H,12-13H2,1-2H3/t19-,20+/m0/s1 |
| InChIKey | QECVDTJEBQOSNU-VQTJNVASSA-N |
| XLogP | 2.57 |
| TPSA | 100.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.53 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|