About 7-methyloctyl 9-(methoxymethyl)fluorene-9-carboxylate
7-methyloctyl 9-(methoxymethyl)fluorene-9-carboxylate (PubChem CID 90407620) has the molecular formula C25H32O3
and a molecular weight of 380.53 g/mol. Its IUPAC name is 7-methyloctyl 9-(methoxymethyl)fluorene-9-carboxylate.
Molecular Properties
| Compound Name | 7-methyloctyl 9-(methoxymethyl)fluorene-9-carboxylate |
| PubChem CID | 90407620 |
| Molecular Formula | C25H32O3 |
| Molecular Weight | 380.53 g/mol |
| Exact Mass | 380.24 |
| IUPAC Name | 7-methyloctyl 9-(methoxymethyl)fluorene-9-carboxylate |
| SMILES | COCC1(C(=O)OCCCCCCC(C)C)c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C25H32O3/c1-19(2)12-6-4-5-11-17-28-24(26)25(18-27-3)22-15-9-7-13-20(22)21-14-8-10-16-23(21)25/h7-10,13-16,19H,4-6,11-12,17-18H2,1-3H3 |
| InChIKey | LGRZHFGCEVQTBA-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 380.53 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 7-methyloctyl 9-(methoxymethyl)fluorene-9-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-methyloctyl 9-(methoxymethyl)fluorene-9-carboxylate?
The IUPAC name of 7-methyloctyl 9-(methoxymethyl)fluorene-9-carboxylate (CID 90407620) is 7-methyloctyl 9-(methoxymethyl)fluorene-9-carboxylate.
What is the SMILES notation for 7-methyloctyl 9-(methoxymethyl)fluorene-9-carboxylate?
The canonical SMILES for 7-methyloctyl 9-(methoxymethyl)fluorene-9-carboxylate is COCC1(C(=O)OCCCCCCC(C)C)c2ccccc2-c2ccccc21.
What is the InChIKey of 7-methyloctyl 9-(methoxymethyl)fluorene-9-carboxylate?
The InChIKey is LGRZHFGCEVQTBA-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H32O3/c1-19(2)12-6-4-5-11-17-28-24(26)25(18-27-3)22-15-9-7-13-20(22)21-14-8-10-16-23(21)25/h7-10,13-16,19H,4-6,11-12,17-18H2,1-3H3.
What are the key properties of 7-methyloctyl 9-(methoxymethyl)fluorene-9-carboxylate?
7-methyloctyl 9-(methoxymethyl)fluorene-9-carboxylate has a molecular weight of 380.53 g/mol, XLogP of 5.75, 10 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-methyloctyl 9-(methoxymethyl)fluorene-9-carboxylate is sourced from PubChem (CID 90407620), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).