C21H15ClN6O — CID 90407772
11-[(3-chlorophenyl)methylamino]-8-phenyl-3,4,8,10,12-pentazatricyclo[7.4.0.02,6]trideca-1(13),2(6),4,9,11-pentaen-7-one (PubChem CID 90407772) has the molecular formula C21H15ClN6O and a molecular weight of 402.85 g/mol. Its IUPAC name is 11-[(3-chlorophenyl)methylamino]-8-phenyl-3,4,8,10,12-pentazatricyclo[7.4.0.02,6]trideca-1(13),2(6),4,9,11-pentaen-7-one.
| Compound Name | 11-[(3-chlorophenyl)methylamino]-8-phenyl-3,4,8,10,12-pentazatricyclo[7.4.0.02,6]trideca-1(13),2(6),4,9,11-pentaen-7-one |
|---|---|
| PubChem CID | 90407772 |
| Molecular Formula | C21H15ClN6O |
| Molecular Weight | 402.85 g/mol |
| Exact Mass | 402.10 |
| IUPAC Name | 11-[(3-chlorophenyl)methylamino]-8-phenyl-3,4,8,10,12-pentazatricyclo[7.4.0.02,6]trideca-1(13),2(6),4,9,11-pentaen-7-one |
| SMILES | O=c1c2cn[nH]c2c2cnc(NCc3cccc(Cl)c3)nc2n1-c1ccccc1 |
| InChI | InChI=1S/C21H15ClN6O/c22-14-6-4-5-13(9-14)10-23-21-24-11-16-18-17(12-25-27-18)20(29)28(19(16)26-21)15-7-2-1-3-8-15/h1-9,11-12H,10H2,(H,25,27)(H,23,24,26) |
| InChIKey | SNEHIEBGLLGGMP-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 88.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.85 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |