C29H38BN3O5 — CID 90408042
N'-tert-butyl-3-(cyanomethoxy)-N'-(3,5-dimethylbenzoyl)-2-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzohydrazide (PubChem CID 90408042) has the molecular formula C29H38BN3O5 and a molecular weight of 519.45 g/mol. Its IUPAC name is N'-tert-butyl-3-(cyanomethoxy)-N'-(3,5-dimethylbenzoyl)-2-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzohydrazide.
| Compound Name | N'-tert-butyl-3-(cyanomethoxy)-N'-(3,5-dimethylbenzoyl)-2-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzohydrazide |
|---|---|
| PubChem CID | 90408042 |
| Molecular Formula | C29H38BN3O5 |
| Molecular Weight | 519.45 g/mol |
| Exact Mass | 519.29 |
| IUPAC Name | N'-tert-butyl-3-(cyanomethoxy)-N'-(3,5-dimethylbenzoyl)-2-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzohydrazide |
| SMILES | Cc1cc(C)cc(C(=O)N(NC(=O)c2ccc(B3OC(C)(C)C(C)(C)O3)c(OCC#N)c2C)C(C)(C)C)c1 |
| InChI | InChI=1S/C29H38BN3O5/c1-18-15-19(2)17-21(16-18)26(35)33(27(4,5)6)32-25(34)22-11-12-23(24(20(22)3)36-14-13-31)30-37-28(7,8)29(9,10)38-30/h11-12,15-17H,14H2,1-10H3,(H,32,34) |
| InChIKey | YIUJPCXJPWTPPU-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 100.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.45 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|