C25H34BFN2O5 — CID 90408165
[3-[[(3,5-dimethylbenzoyl)-(2,2-dimethylpentan-3-yl)amino]carbamoyl]-2-fluoro-6-(methoxymethyl)phenyl]boronic acid (PubChem CID 90408165) has the molecular formula C25H34BFN2O5 and a molecular weight of 472.37 g/mol. Its IUPAC name is [3-[[(3,5-dimethylbenzoyl)-(2,2-dimethylpentan-3-yl)amino]carbamoyl]-2-fluoro-6-(methoxymethyl)phenyl]boronic acid.
| Compound Name | [3-[[(3,5-dimethylbenzoyl)-(2,2-dimethylpentan-3-yl)amino]carbamoyl]-2-fluoro-6-(methoxymethyl)phenyl]boronic acid |
|---|---|
| PubChem CID | 90408165 |
| Molecular Formula | C25H34BFN2O5 |
| Molecular Weight | 472.37 g/mol |
| Exact Mass | 472.25 |
| IUPAC Name | [3-[[(3,5-dimethylbenzoyl)-(2,2-dimethylpentan-3-yl)amino]carbamoyl]-2-fluoro-6-(methoxymethyl)phenyl]boronic acid |
| SMILES | CCC(N(NC(=O)c1ccc(COC)c(B(O)O)c1F)C(=O)c1cc(C)cc(C)c1)C(C)(C)C |
| InChI | InChI=1S/C25H34BFN2O5/c1-8-20(25(4,5)6)29(24(31)18-12-15(2)11-16(3)13-18)28-23(30)19-10-9-17(14-34-7)21(22(19)27)26(32)33/h9-13,20,32-33H,8,14H2,1-7H3,(H,28,30) |
| InChIKey | JJNAOTDRDJNNIX-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 99.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.37 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|