C24H30BFN2O4 — CID 90408217
N'-(3,5-dimethylbenzoyl)-N'-(2,2-dimethylpentan-3-yl)-4-fluoro-1-hydroxy-3H-2,1-benzoxaborole-5-carbohydrazide (PubChem CID 90408217) has the molecular formula C24H30BFN2O4 and a molecular weight of 440.32 g/mol. Its IUPAC name is N'-(3,5-dimethylbenzoyl)-N'-(2,2-dimethylpentan-3-yl)-4-fluoro-1-hydroxy-3H-2,1-benzoxaborole-5-carbohydrazide.
| Compound Name | N'-(3,5-dimethylbenzoyl)-N'-(2,2-dimethylpentan-3-yl)-4-fluoro-1-hydroxy-3H-2,1-benzoxaborole-5-carbohydrazide |
|---|---|
| PubChem CID | 90408217 |
| Molecular Formula | C24H30BFN2O4 |
| Molecular Weight | 440.32 g/mol |
| Exact Mass | 440.23 |
| IUPAC Name | N'-(3,5-dimethylbenzoyl)-N'-(2,2-dimethylpentan-3-yl)-4-fluoro-1-hydroxy-3H-2,1-benzoxaborole-5-carbohydrazide |
| SMILES | CCC(N(NC(=O)c1ccc2c(c1F)COB2O)C(=O)c1cc(C)cc(C)c1)C(C)(C)C |
| InChI | InChI=1S/C24H30BFN2O4/c1-7-20(24(4,5)6)28(23(30)16-11-14(2)10-15(3)12-16)27-22(29)17-8-9-19-18(21(17)26)13-32-25(19)31/h8-12,20,31H,7,13H2,1-6H3,(H,27,29) |
| InChIKey | JZVYEHTVQNCPQU-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.32 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|