C27H41BO6 — CID 90408655
tert-butyl 2-[2-[1-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-2-oxabicyclo[2.2.2]octan-4-yl]ethoxy]acetate (PubChem CID 90408655) has the molecular formula C27H41BO6 and a molecular weight of 472.43 g/mol. Its IUPAC name is tert-butyl 2-[2-[1-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-2-oxabicyclo[2.2.2]octan-4-yl]ethoxy]acetate.
| Compound Name | tert-butyl 2-[2-[1-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-2-oxabicyclo[2.2.2]octan-4-yl]ethoxy]acetate |
|---|---|
| PubChem CID | 90408655 |
| Molecular Formula | C27H41BO6 |
| Molecular Weight | 472.43 g/mol |
| Exact Mass | 472.30 |
| IUPAC Name | tert-butyl 2-[2-[1-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-2-oxabicyclo[2.2.2]octan-4-yl]ethoxy]acetate |
| SMILES | CC(C)(C)OC(=O)COCCC12CCC(c3cccc(B4OC(C)(C)C(C)(C)O4)c3)(CC1)OC2 |
| InChI | InChI=1S/C27H41BO6/c1-23(2,3)32-22(29)18-30-16-15-26-11-13-27(14-12-26,31-19-26)20-9-8-10-21(17-20)28-33-24(4,5)25(6,7)34-28/h8-10,17H,11-16,18-19H2,1-7H3 |
| InChIKey | OWZKJXUYJXYYMN-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.43 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|