C25H24FN9O2 — CID 90408687
5-amino-11-[[(2R)-6-amino-4-methyl-2,3-dihydro-1,4-benzoxazin-2-yl]methyl-methylamino]-8-(2-fluorophenyl)-3,4,8,10,12-pentazatricyclo[7.4.0.02,6]trideca-1(13),2(6),4,9,11-pentaen-7-one (PubChem CID 90408687) has the molecular formula C25H24FN9O2 and a molecular weight of 501.53 g/mol. Its IUPAC name is 5-amino-11-[[(2R)-6-amino-4-methyl-2,3-dihydro-1,4-benzoxazin-2-yl]methyl-methylamino]-8-(2-fluorophenyl)-3,4,8,10,12-pentazatricyclo[7.4.0.02,6]trideca-1(13),2(6),4,9,11-pentaen-7-one.
| Compound Name | 5-amino-11-[[(2R)-6-amino-4-methyl-2,3-dihydro-1,4-benzoxazin-2-yl]methyl-methylamino]-8-(2-fluorophenyl)-3,4,8,10,12-pentazatricyclo[7.4.0.02,6]trideca-1(13),2(6),4,9,11-pentaen-7-one |
|---|---|
| PubChem CID | 90408687 |
| Molecular Formula | C25H24FN9O2 |
| Molecular Weight | 501.53 g/mol |
| Exact Mass | 501.20 |
| IUPAC Name | 5-amino-11-[[(2R)-6-amino-4-methyl-2,3-dihydro-1,4-benzoxazin-2-yl]methyl-methylamino]-8-(2-fluorophenyl)-3,4,8,10,12-pentazatricyclo[7.4.0.02,6]trideca-1(13),2(6),4,9,11-pentaen-7-one |
| SMILES | CN(C[C@H]1CN(C)c2cc(N)ccc2O1)c1ncc2c3[nH]nc(N)c3c(=O)n(-c3ccccc3F)c2n1 |
| InChI | InChI=1S/C25H24FN9O2/c1-33-11-14(37-19-8-7-13(27)9-18(19)33)12-34(2)25-29-10-15-21-20(22(28)32-31-21)24(36)35(23(15)30-25)17-6-4-3-5-16(17)26/h3-10,14H,11-12,27H2,1-2H3,(H3,28,31,32)/t14-/m1/s1 |
| InChIKey | MLQXSESXZJNCOG-CQSZACIVSA-N |
| XLogP | 2.29 |
| TPSA | 144.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.53 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|