About azane;4-(5-fluoropyrimidin-2-yl)pyridin-3-amine
azane;4-(5-fluoropyrimidin-2-yl)pyridin-3-amine (PubChem CID 90408875) has the molecular formula C9H10FN5
and a molecular weight of 207.21 g/mol. Its IUPAC name is azane;4-(5-fluoropyrimidin-2-yl)pyridin-3-amine.
Molecular Properties
| Compound Name | azane;4-(5-fluoropyrimidin-2-yl)pyridin-3-amine |
| PubChem CID | 90408875 |
| Molecular Formula | C9H10FN5 |
| Molecular Weight | 207.21 g/mol |
| Exact Mass | 207.09 |
| IUPAC Name | azane;4-(5-fluoropyrimidin-2-yl)pyridin-3-amine |
| SMILES | N.Nc1cnccc1-c1ncc(F)cn1 |
| InChI | InChI=1S/C9H7FN4.H3N/c10-6-3-13-9(14-4-6)7-1-2-12-5-8(7)11;/h1-5H,11H2;1H3 |
| InChIKey | ZXVURTKPVPVWKA-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 99.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.21 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze azane;4-(5-fluoropyrimidin-2-yl)pyridin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;4-(5-fluoropyrimidin-2-yl)pyridin-3-amine?
The IUPAC name of azane;4-(5-fluoropyrimidin-2-yl)pyridin-3-amine (CID 90408875) is azane;4-(5-fluoropyrimidin-2-yl)pyridin-3-amine.
What is the SMILES notation for azane;4-(5-fluoropyrimidin-2-yl)pyridin-3-amine?
The canonical SMILES for azane;4-(5-fluoropyrimidin-2-yl)pyridin-3-amine is N.Nc1cnccc1-c1ncc(F)cn1.
What is the InChIKey of azane;4-(5-fluoropyrimidin-2-yl)pyridin-3-amine?
The InChIKey is ZXVURTKPVPVWKA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7FN4.H3N/c10-6-3-13-9(14-4-6)7-1-2-12-5-8(7)11;/h1-5H,11H2;1H3.
What are the key properties of azane;4-(5-fluoropyrimidin-2-yl)pyridin-3-amine?
azane;4-(5-fluoropyrimidin-2-yl)pyridin-3-amine has a molecular weight of 207.21 g/mol, XLogP of 1.42, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for azane;4-(5-fluoropyrimidin-2-yl)pyridin-3-amine is sourced from PubChem (CID 90408875), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).