C20H20N6O3 — CID 90408931
11-[1,4-dioxan-2-ylmethyl(methyl)amino]-8-phenyl-3,4,8,10,12-pentazatricyclo[7.4.0.02,6]trideca-1(13),2(6),4,9,11-pentaen-7-one (PubChem CID 90408931) has the molecular formula C20H20N6O3 and a molecular weight of 392.42 g/mol. Its IUPAC name is 11-[1,4-dioxan-2-ylmethyl(methyl)amino]-8-phenyl-3,4,8,10,12-pentazatricyclo[7.4.0.02,6]trideca-1(13),2(6),4,9,11-pentaen-7-one.
| Compound Name | 11-[1,4-dioxan-2-ylmethyl(methyl)amino]-8-phenyl-3,4,8,10,12-pentazatricyclo[7.4.0.02,6]trideca-1(13),2(6),4,9,11-pentaen-7-one |
|---|---|
| PubChem CID | 90408931 |
| Molecular Formula | C20H20N6O3 |
| Molecular Weight | 392.42 g/mol |
| Exact Mass | 392.16 |
| IUPAC Name | 11-[1,4-dioxan-2-ylmethyl(methyl)amino]-8-phenyl-3,4,8,10,12-pentazatricyclo[7.4.0.02,6]trideca-1(13),2(6),4,9,11-pentaen-7-one |
| SMILES | CN(CC1COCCO1)c1ncc2c3[nH]ncc3c(=O)n(-c3ccccc3)c2n1 |
| InChI | InChI=1S/C20H20N6O3/c1-25(11-14-12-28-7-8-29-14)20-21-9-15-17-16(10-22-24-17)19(27)26(18(15)23-20)13-5-3-2-4-6-13/h2-6,9-10,14H,7-8,11-12H2,1H3,(H,22,24) |
| InChIKey | MAPNRQCEADKEKP-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 98.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.42 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |