C18H20FN7O2 — CID 90408970
5-amino-11-(2-fluoroethyl)-N-(4-methoxy-3-pyridinyl)-2,6,7,11-tetrazatricyclo[7.4.0.03,7]trideca-1,3,5,8-tetraene-4-carboxamide (PubChem CID 90408970) has the molecular formula C18H20FN7O2 and a molecular weight of 385.40 g/mol. Its IUPAC name is 5-amino-11-(2-fluoroethyl)-N-(4-methoxy-3-pyridinyl)-2,6,7,11-tetrazatricyclo[7.4.0.03,7]trideca-1,3,5,8-tetraene-4-carboxamide.
| Compound Name | 5-amino-11-(2-fluoroethyl)-N-(4-methoxy-3-pyridinyl)-2,6,7,11-tetrazatricyclo[7.4.0.03,7]trideca-1,3,5,8-tetraene-4-carboxamide |
|---|---|
| PubChem CID | 90408970 |
| Molecular Formula | C18H20FN7O2 |
| Molecular Weight | 385.40 g/mol |
| Exact Mass | 385.17 |
| IUPAC Name | 5-amino-11-(2-fluoroethyl)-N-(4-methoxy-3-pyridinyl)-2,6,7,11-tetrazatricyclo[7.4.0.03,7]trideca-1,3,5,8-tetraene-4-carboxamide |
| SMILES | COc1ccncc1NC(=O)c1c(N)nn2cc3c(nc12)CCN(CCF)C3 |
| InChI | InChI=1S/C18H20FN7O2/c1-28-14-2-5-21-8-13(14)23-18(27)15-16(20)24-26-10-11-9-25(7-4-19)6-3-12(11)22-17(15)26/h2,5,8,10H,3-4,6-7,9H2,1H3,(H2,20,24)(H,23,27) |
| InChIKey | SGHDCKBQWRINIS-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 110.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.40 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |