About 2-[2-[1-[3-(3,4-difluorophenoxy)phenyl]-2-oxabicyclo[2.2.2]octan-4-yl]ethoxy]acetic acid
2-[2-[1-[3-(3,4-difluorophenoxy)phenyl]-2-oxabicyclo[2.2.2]octan-4-yl]ethoxy]acetic acid (PubChem CID 90408995) has the molecular formula C23H24F2O5
and a molecular weight of 418.44 g/mol. Its IUPAC name is 2-[2-[1-[3-(3,4-difluorophenoxy)phenyl]-2-oxabicyclo[2.2.2]octan-4-yl]ethoxy]acetic acid.
Molecular Properties
| Compound Name | 2-[2-[1-[3-(3,4-difluorophenoxy)phenyl]-2-oxabicyclo[2.2.2]octan-4-yl]ethoxy]acetic acid |
| PubChem CID | 90408995 |
| Molecular Formula | C23H24F2O5 |
| Molecular Weight | 418.44 g/mol |
| Exact Mass | 418.16 |
| IUPAC Name | 2-[2-[1-[3-(3,4-difluorophenoxy)phenyl]-2-oxabicyclo[2.2.2]octan-4-yl]ethoxy]acetic acid |
| SMILES | O=C(O)COCCC12CCC(c3cccc(Oc4ccc(F)c(F)c4)c3)(CC1)OC2 |
| InChI | InChI=1S/C23H24F2O5/c24-19-5-4-18(13-20(19)25)30-17-3-1-2-16(12-17)23-8-6-22(7-9-23,15-29-23)10-11-28-14-21(26)27/h1-5,12-13H,6-11,14-15H2,(H,26,27) |
| InChIKey | ICQSYYWSBRTDEX-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 418.44 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-[1-[3-(3,4-difluorophenoxy)phenyl]-2-oxabicyclo[2.2.2]octan-4-yl]ethoxy]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-[1-[3-(3,4-difluorophenoxy)phenyl]-2-oxabicyclo[2.2.2]octan-4-yl]ethoxy]acetic acid?
The IUPAC name of 2-[2-[1-[3-(3,4-difluorophenoxy)phenyl]-2-oxabicyclo[2.2.2]octan-4-yl]ethoxy]acetic acid (CID 90408995) is 2-[2-[1-[3-(3,4-difluorophenoxy)phenyl]-2-oxabicyclo[2.2.2]octan-4-yl]ethoxy]acetic acid.
What is the SMILES notation for 2-[2-[1-[3-(3,4-difluorophenoxy)phenyl]-2-oxabicyclo[2.2.2]octan-4-yl]ethoxy]acetic acid?
The canonical SMILES for 2-[2-[1-[3-(3,4-difluorophenoxy)phenyl]-2-oxabicyclo[2.2.2]octan-4-yl]ethoxy]acetic acid is O=C(O)COCCC12CCC(c3cccc(Oc4ccc(F)c(F)c4)c3)(CC1)OC2.
What is the InChIKey of 2-[2-[1-[3-(3,4-difluorophenoxy)phenyl]-2-oxabicyclo[2.2.2]octan-4-yl]ethoxy]acetic acid?
The InChIKey is ICQSYYWSBRTDEX-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H24F2O5/c24-19-5-4-18(13-20(19)25)30-17-3-1-2-16(12-17)23-8-6-22(7-9-23,15-29-23)10-11-28-14-21(26)27/h1-5,12-13H,6-11,14-15H2,(H,26,27).
What are the key properties of 2-[2-[1-[3-(3,4-difluorophenoxy)phenyl]-2-oxabicyclo[2.2.2]octan-4-yl]ethoxy]acetic acid?
2-[2-[1-[3-(3,4-difluorophenoxy)phenyl]-2-oxabicyclo[2.2.2]octan-4-yl]ethoxy]acetic acid has a molecular weight of 418.44 g/mol, XLogP of 5.03, 8 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-[1-[3-(3,4-difluorophenoxy)phenyl]-2-oxabicyclo[2.2.2]octan-4-yl]ethoxy]acetic acid is sourced from PubChem (CID 90408995), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).