C18H18F3N7O2 — CID 90409024
5-amino-11-methyl-N-[4-(2,2,2-trifluoroethoxy)-3-pyridinyl]-2,6,7,11-tetrazatricyclo[7.4.0.03,7]trideca-1,3,5,8-tetraene-4-carboxamide (PubChem CID 90409024) has the molecular formula C18H18F3N7O2 and a molecular weight of 421.38 g/mol. Its IUPAC name is 5-amino-11-methyl-N-[4-(2,2,2-trifluoroethoxy)-3-pyridinyl]-2,6,7,11-tetrazatricyclo[7.4.0.03,7]trideca-1,3,5,8-tetraene-4-carboxamide.
| Compound Name | 5-amino-11-methyl-N-[4-(2,2,2-trifluoroethoxy)-3-pyridinyl]-2,6,7,11-tetrazatricyclo[7.4.0.03,7]trideca-1,3,5,8-tetraene-4-carboxamide |
|---|---|
| PubChem CID | 90409024 |
| Molecular Formula | C18H18F3N7O2 |
| Molecular Weight | 421.38 g/mol |
| Exact Mass | 421.15 |
| IUPAC Name | 5-amino-11-methyl-N-[4-(2,2,2-trifluoroethoxy)-3-pyridinyl]-2,6,7,11-tetrazatricyclo[7.4.0.03,7]trideca-1,3,5,8-tetraene-4-carboxamide |
| SMILES | CN1CCc2nc3c(C(=O)Nc4cnccc4OCC(F)(F)F)c(N)nn3cc2C1 |
| InChI | InChI=1S/C18H18F3N7O2/c1-27-5-3-11-10(7-27)8-28-16(24-11)14(15(22)26-28)17(29)25-12-6-23-4-2-13(12)30-9-18(19,20)21/h2,4,6,8H,3,5,7,9H2,1H3,(H2,22,26)(H,25,29) |
| InChIKey | XDXLIFDGYCWNML-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 110.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.38 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |