C21H20N4O3 — CID 90409671
7-(3,5-dimethyl-1,2-oxazol-4-yl)-11-ethyl-11-pyridin-2-yl-9-oxa-1,3-diazatricyclo[6.3.1.04,12]dodeca-4(12),5,7-trien-2-one (PubChem CID 90409671) has the molecular formula C21H20N4O3 and a molecular weight of 376.42 g/mol. Its IUPAC name is 7-(3,5-dimethyl-1,2-oxazol-4-yl)-11-ethyl-11-pyridin-2-yl-9-oxa-1,3-diazatricyclo[6.3.1.04,12]dodeca-4(12),5,7-trien-2-one.
| Compound Name | 7-(3,5-dimethyl-1,2-oxazol-4-yl)-11-ethyl-11-pyridin-2-yl-9-oxa-1,3-diazatricyclo[6.3.1.04,12]dodeca-4(12),5,7-trien-2-one |
|---|---|
| PubChem CID | 90409671 |
| Molecular Formula | C21H20N4O3 |
| Molecular Weight | 376.42 g/mol |
| Exact Mass | 376.15 |
| IUPAC Name | 7-(3,5-dimethyl-1,2-oxazol-4-yl)-11-ethyl-11-pyridin-2-yl-9-oxa-1,3-diazatricyclo[6.3.1.04,12]dodeca-4(12),5,7-trien-2-one |
| SMILES | CCC1(c2ccccn2)COc2c(-c3c(C)noc3C)ccc3[nH]c(=O)n1c23 |
| InChI | InChI=1S/C21H20N4O3/c1-4-21(16-7-5-6-10-22-16)11-27-19-14(17-12(2)24-28-13(17)3)8-9-15-18(19)25(21)20(26)23-15/h5-10H,4,11H2,1-3H3,(H,23,26) |
| InChIKey | AWTRPDMNPPPFGX-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 85.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.42 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |