C14H11ClF2N2O3 — CID 90409767
4-amino-3-chloro-6-[4-(difluoromethoxy)phenyl]-5-methylpyridine-2-carboxylic acid (PubChem CID 90409767) has the molecular formula C14H11ClF2N2O3 and a molecular weight of 328.70 g/mol. Its IUPAC name is 4-amino-3-chloro-6-[4-(difluoromethoxy)phenyl]-5-methylpyridine-2-carboxylic acid.
| Compound Name | 4-amino-3-chloro-6-[4-(difluoromethoxy)phenyl]-5-methylpyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 90409767 |
| Molecular Formula | C14H11ClF2N2O3 |
| Molecular Weight | 328.70 g/mol |
| Exact Mass | 328.04 |
| IUPAC Name | 4-amino-3-chloro-6-[4-(difluoromethoxy)phenyl]-5-methylpyridine-2-carboxylic acid |
| SMILES | Cc1c(-c2ccc(OC(F)F)cc2)nc(C(=O)O)c(Cl)c1N |
| InChI | InChI=1S/C14H11ClF2N2O3/c1-6-10(18)9(15)12(13(20)21)19-11(6)7-2-4-8(5-3-7)22-14(16)17/h2-5,14H,1H3,(H2,18,19)(H,20,21) |
| InChIKey | JGBLWCUULIHXIN-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 85.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.70 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |