C18H28O2 — CID 90410403
(3aS,5aS,6aS,8R,10aR,11aS,11bR)-8-hydroxy-3a-methyl-3,4,5,5a,6,6a,7,8,9,10,10a,11,11a,11b-tetradecahydro-1H-cyclopenta[a]anthracen-2-one (PubChem CID 90410403) has the molecular formula C18H28O2 and a molecular weight of 276.42 g/mol. Its IUPAC name is (3aS,5aS,6aS,8R,10aR,11aS,11bR)-8-hydroxy-3a-methyl-3,4,5,5a,6,6a,7,8,9,10,10a,11,11a,11b-tetradecahydro-1H-cyclopenta[a]anthracen-2-one.
| Compound Name | (3aS,5aS,6aS,8R,10aR,11aS,11bR)-8-hydroxy-3a-methyl-3,4,5,5a,6,6a,7,8,9,10,10a,11,11a,11b-tetradecahydro-1H-cyclopenta[a]anthracen-2-one |
|---|---|
| PubChem CID | 90410403 |
| Molecular Formula | C18H28O2 |
| Molecular Weight | 276.42 g/mol |
| Exact Mass | 276.21 |
| IUPAC Name | (3aS,5aS,6aS,8R,10aR,11aS,11bR)-8-hydroxy-3a-methyl-3,4,5,5a,6,6a,7,8,9,10,10a,11,11a,11b-tetradecahydro-1H-cyclopenta[a]anthracen-2-one |
| SMILES | C[C@@]12CC[C@H]3C[C@H]4C[C@H](O)CC[C@@H]4C[C@@H]3[C@H]1CC(=O)C2 |
| InChI | InChI=1S/C18H28O2/c1-18-5-4-12-6-13-7-14(19)3-2-11(13)8-16(12)17(18)9-15(20)10-18/h11-14,16-17,19H,2-10H2,1H3/t11-,12+,13+,14-,16+,17-,18+/m1/s1 |
| InChIKey | BUCRQWHEHYTEIG-YEJXPRSCSA-N |
| XLogP | 3.57 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.42 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |