About [(S)-1-(2,4-dioxo-1H-pyrimidin-3-yl)propan-2-yloxy-methoxymethyl]phosphonic acid
[(S)-1-(2,4-dioxo-1H-pyrimidin-3-yl)propan-2-yloxy-methoxymethyl]phosphonic acid (PubChem CID 90410581) has the molecular formula C9H15N2O7P
and a molecular weight of 294.20 g/mol. Its IUPAC name is [(S)-1-(2,4-dioxo-1H-pyrimidin-3-yl)propan-2-yloxy-methoxymethyl]phosphonic acid.
Molecular Properties
| Compound Name | [(S)-1-(2,4-dioxo-1H-pyrimidin-3-yl)propan-2-yloxy-methoxymethyl]phosphonic acid |
| PubChem CID | 90410581 |
| Molecular Formula | C9H15N2O7P |
| Molecular Weight | 294.20 g/mol |
| Exact Mass | 294.06 |
| IUPAC Name | [(S)-1-(2,4-dioxo-1H-pyrimidin-3-yl)propan-2-yloxy-methoxymethyl]phosphonic acid |
| SMILES | CO[C@@H](OC(C)Cn1c(=O)cc[nH]c1=O)P(=O)(O)O |
| InChI | InChI=1S/C9H15N2O7P/c1-6(18-9(17-2)19(14,15)16)5-11-7(12)3-4-10-8(11)13/h3-4,6,9H,5H2,1-2H3,(H,10,13)(H2,14,15,16)/t6?,9-/m0/s1 |
| InChIKey | CSDJVHJMIZWBJH-HSOSERFQSA-N |
| XLogP | -0.95 |
| TPSA | 130.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.20 |
| LogP ≤ 5 | -0.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze [(S)-1-(2,4-dioxo-1H-pyrimidin-3-yl)propan-2-yloxy-methoxymethyl]phosphonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(S)-1-(2,4-dioxo-1H-pyrimidin-3-yl)propan-2-yloxy-methoxymethyl]phosphonic acid?
The IUPAC name of [(S)-1-(2,4-dioxo-1H-pyrimidin-3-yl)propan-2-yloxy-methoxymethyl]phosphonic acid (CID 90410581) is [(S)-1-(2,4-dioxo-1H-pyrimidin-3-yl)propan-2-yloxy-methoxymethyl]phosphonic acid.
What is the SMILES notation for [(S)-1-(2,4-dioxo-1H-pyrimidin-3-yl)propan-2-yloxy-methoxymethyl]phosphonic acid?
The canonical SMILES for [(S)-1-(2,4-dioxo-1H-pyrimidin-3-yl)propan-2-yloxy-methoxymethyl]phosphonic acid is CO[C@@H](OC(C)Cn1c(=O)cc[nH]c1=O)P(=O)(O)O.
What is the InChIKey of [(S)-1-(2,4-dioxo-1H-pyrimidin-3-yl)propan-2-yloxy-methoxymethyl]phosphonic acid?
The InChIKey is CSDJVHJMIZWBJH-HSOSERFQSA-N. The full InChI is InChI=1S/C9H15N2O7P/c1-6(18-9(17-2)19(14,15)16)5-11-7(12)3-4-10-8(11)13/h3-4,6,9H,5H2,1-2H3,(H,10,13)(H2,14,15,16)/t6?,9-/m0/s1.
What are the key properties of [(S)-1-(2,4-dioxo-1H-pyrimidin-3-yl)propan-2-yloxy-methoxymethyl]phosphonic acid?
[(S)-1-(2,4-dioxo-1H-pyrimidin-3-yl)propan-2-yloxy-methoxymethyl]phosphonic acid has a molecular weight of 294.20 g/mol, XLogP of -0.95, 6 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [(S)-1-(2,4-dioxo-1H-pyrimidin-3-yl)propan-2-yloxy-methoxymethyl]phosphonic acid is sourced from PubChem (CID 90410581), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).