C11H16BrN3O3S — CID 90410961
[4-[(5-bromopyrimidin-2-yl)amino]cyclohexyl] methanesulfonate (PubChem CID 90410961) has the molecular formula C11H16BrN3O3S and a molecular weight of 350.24 g/mol. Its IUPAC name is [4-[(5-bromopyrimidin-2-yl)amino]cyclohexyl] methanesulfonate.
| Compound Name | [4-[(5-bromopyrimidin-2-yl)amino]cyclohexyl] methanesulfonate |
|---|---|
| PubChem CID | 90410961 |
| Molecular Formula | C11H16BrN3O3S |
| Molecular Weight | 350.24 g/mol |
| Exact Mass | 349.01 |
| IUPAC Name | [4-[(5-bromopyrimidin-2-yl)amino]cyclohexyl] methanesulfonate |
| SMILES | CS(=O)(=O)OC1CCC(Nc2ncc(Br)cn2)CC1 |
| InChI | InChI=1S/C11H16BrN3O3S/c1-19(16,17)18-10-4-2-9(3-5-10)15-11-13-6-8(12)7-14-11/h6-7,9-10H,2-5H2,1H3,(H,13,14,15) |
| InChIKey | HLNOXNQMAVBKPE-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.24 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|