C19H23BFNO2 — CID 90411214
N-benzyl-4-fluoro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline (PubChem CID 90411214) has the molecular formula C19H23BFNO2 and a molecular weight of 327.21 g/mol. Its IUPAC name is N-benzyl-4-fluoro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline.
| Compound Name | N-benzyl-4-fluoro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline |
|---|---|
| PubChem CID | 90411214 |
| Molecular Formula | C19H23BFNO2 |
| Molecular Weight | 327.21 g/mol |
| Exact Mass | 327.18 |
| IUPAC Name | N-benzyl-4-fluoro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline |
| SMILES | CC1(C)OB(c2cc(NCc3ccccc3)ccc2F)OC1(C)C |
| InChI | InChI=1S/C19H23BFNO2/c1-18(2)19(3,4)24-20(23-18)16-12-15(10-11-17(16)21)22-13-14-8-6-5-7-9-14/h5-12,22H,13H2,1-4H3 |
| InChIKey | YGIMTYJHXGTHAC-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.21 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|