C11H17ClN2O — CID 90411328
6-(dimethylamino)-1,2,3,4-tetrahydroisoquinolin-5-ol;hydrochloride (PubChem CID 90411328) has the molecular formula C11H17ClN2O and a molecular weight of 228.72 g/mol. Its IUPAC name is 6-(dimethylamino)-1,2,3,4-tetrahydroisoquinolin-5-ol;hydrochloride.
| Compound Name | 6-(dimethylamino)-1,2,3,4-tetrahydroisoquinolin-5-ol;hydrochloride |
|---|---|
| PubChem CID | 90411328 |
| Molecular Formula | C11H17ClN2O |
| Molecular Weight | 228.72 g/mol |
| Exact Mass | 228.10 |
| IUPAC Name | 6-(dimethylamino)-1,2,3,4-tetrahydroisoquinolin-5-ol;hydrochloride |
| SMILES | CN(C)c1ccc2c(c1O)CCNC2.Cl |
| InChI | InChI=1S/C11H16N2O.ClH/c1-13(2)10-4-3-8-7-12-6-5-9(8)11(10)14;/h3-4,12,14H,5-7H2,1-2H3;1H |
| InChIKey | VFAWQEBUMZIPRX-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.72 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|