C16H14F2N4O2 — CID 90411492
3-(3,5-difluorophenyl)-N-methoxy-N,5-dimethylimidazo[1,2-c]pyrimidine-2-carboxamide (PubChem CID 90411492) has the molecular formula C16H14F2N4O2 and a molecular weight of 332.31 g/mol. Its IUPAC name is 3-(3,5-difluorophenyl)-N-methoxy-N,5-dimethylimidazo[1,2-c]pyrimidine-2-carboxamide.
| Compound Name | 3-(3,5-difluorophenyl)-N-methoxy-N,5-dimethylimidazo[1,2-c]pyrimidine-2-carboxamide |
|---|---|
| PubChem CID | 90411492 |
| Molecular Formula | C16H14F2N4O2 |
| Molecular Weight | 332.31 g/mol |
| Exact Mass | 332.11 |
| IUPAC Name | 3-(3,5-difluorophenyl)-N-methoxy-N,5-dimethylimidazo[1,2-c]pyrimidine-2-carboxamide |
| SMILES | CON(C)C(=O)c1nc2ccnc(C)n2c1-c1cc(F)cc(F)c1 |
| InChI | InChI=1S/C16H14F2N4O2/c1-9-19-5-4-13-20-14(16(23)21(2)24-3)15(22(9)13)10-6-11(17)8-12(18)7-10/h4-8H,1-3H3 |
| InChIKey | FGPCNHCQSYYMSV-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 59.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.31 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|