C8H11NO — CID 90412226
2,3,3a,4,7,7a-hexahydro-1H-4,7-epoxyisoindole (PubChem CID 90412226) has the molecular formula C8H11NO and a molecular weight of 137.18 g/mol. Its IUPAC name is 2,3,3a,4,7,7a-hexahydro-1H-4,7-epoxyisoindole.
| Compound Name | 2,3,3a,4,7,7a-hexahydro-1H-4,7-epoxyisoindole |
|---|---|
| PubChem CID | 90412226 |
| Molecular Formula | C8H11NO |
| Molecular Weight | 137.18 g/mol |
| Exact Mass | 137.08 |
| IUPAC Name | 2,3,3a,4,7,7a-hexahydro-1H-4,7-epoxyisoindole |
| SMILES | C1=CC2OC1C1CNCC21 |
| InChI | InChI=1S/C8H11NO/c1-2-8-6-4-9-3-5(6)7(1)10-8/h1-2,5-9H,3-4H2 |
| InChIKey | LIZJPQHTBVGJHF-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 137.18 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|