C23H27FN4O3 — CID 90412643
1-[4-[4-(5-fluoro-2-methoxyphenyl)-1H-pyrrolo[2,3-b]pyridin-2-yl]piperidin-1-yl]-2-(2-hydroxyethylamino)ethanone (PubChem CID 90412643) has the molecular formula C23H27FN4O3 and a molecular weight of 426.49 g/mol. Its IUPAC name is 1-[4-[4-(5-fluoro-2-methoxyphenyl)-1H-pyrrolo[2,3-b]pyridin-2-yl]piperidin-1-yl]-2-(2-hydroxyethylamino)ethanone.
| Compound Name | 1-[4-[4-(5-fluoro-2-methoxyphenyl)-1H-pyrrolo[2,3-b]pyridin-2-yl]piperidin-1-yl]-2-(2-hydroxyethylamino)ethanone |
|---|---|
| PubChem CID | 90412643 |
| Molecular Formula | C23H27FN4O3 |
| Molecular Weight | 426.49 g/mol |
| Exact Mass | 426.21 |
| IUPAC Name | 1-[4-[4-(5-fluoro-2-methoxyphenyl)-1H-pyrrolo[2,3-b]pyridin-2-yl]piperidin-1-yl]-2-(2-hydroxyethylamino)ethanone |
| SMILES | COc1ccc(F)cc1-c1ccnc2[nH]c(C3CCN(C(=O)CNCCO)CC3)cc12 |
| InChI | InChI=1S/C23H27FN4O3/c1-31-21-3-2-16(24)12-18(21)17-4-7-26-23-19(17)13-20(27-23)15-5-9-28(10-6-15)22(30)14-25-8-11-29/h2-4,7,12-13,15,25,29H,5-6,8-11,14H2,1H3,(H,26,27) |
| InChIKey | QTROMHAUINAJRE-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 90.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.49 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|