About 8-methyl-2,3,5,6-tetrahydroimidazo[1,2-a]pyrazine
8-methyl-2,3,5,6-tetrahydroimidazo[1,2-a]pyrazine (PubChem CID 90412699) has the molecular formula C7H11N3
and a molecular weight of 137.19 g/mol. Its IUPAC name is 8-methyl-2,3,5,6-tetrahydroimidazo[1,2-a]pyrazine.
Analyze 8-methyl-2,3,5,6-tetrahydroimidazo[1,2-a]pyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-methyl-2,3,5,6-tetrahydroimidazo[1,2-a]pyrazine?
The IUPAC name of 8-methyl-2,3,5,6-tetrahydroimidazo[1,2-a]pyrazine (CID 90412699) is 8-methyl-2,3,5,6-tetrahydroimidazo[1,2-a]pyrazine.
What is the SMILES notation for 8-methyl-2,3,5,6-tetrahydroimidazo[1,2-a]pyrazine?
The canonical SMILES for 8-methyl-2,3,5,6-tetrahydroimidazo[1,2-a]pyrazine is CC1=NCCN2CCN=C12.
What is the InChIKey of 8-methyl-2,3,5,6-tetrahydroimidazo[1,2-a]pyrazine?
The InChIKey is UUBGIELUPLJXBD-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11N3/c1-6-7-9-3-5-10(7)4-2-8-6/h2-5H2,1H3.
What are the key properties of 8-methyl-2,3,5,6-tetrahydroimidazo[1,2-a]pyrazine?
8-methyl-2,3,5,6-tetrahydroimidazo[1,2-a]pyrazine has a molecular weight of 137.19 g/mol, XLogP of 0.17, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-methyl-2,3,5,6-tetrahydroimidazo[1,2-a]pyrazine is sourced from PubChem (CID 90412699), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).