C23H34BN3O4 — CID 90413258
tert-butyl 4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrrolo[2,3-b]pyridin-2-yl]piperidine-1-carboxylate (PubChem CID 90413258) has the molecular formula C23H34BN3O4 and a molecular weight of 427.35 g/mol. Its IUPAC name is tert-butyl 4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrrolo[2,3-b]pyridin-2-yl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrrolo[2,3-b]pyridin-2-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 90413258 |
| Molecular Formula | C23H34BN3O4 |
| Molecular Weight | 427.35 g/mol |
| Exact Mass | 427.26 |
| IUPAC Name | tert-butyl 4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrrolo[2,3-b]pyridin-2-yl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(c2cc3c(B4OC(C)(C)C(C)(C)O4)ccnc3[nH]2)CC1 |
| InChI | InChI=1S/C23H34BN3O4/c1-21(2,3)29-20(28)27-12-9-15(10-13-27)18-14-16-17(8-11-25-19(16)26-18)24-30-22(4,5)23(6,7)31-24/h8,11,14-15H,9-10,12-13H2,1-7H3,(H,25,26) |
| InChIKey | QNSPOIICAZAAPW-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 76.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.35 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|