C21H16ClF4N5O — CID 90413841
[2-chloro-3-(trifluoromethyl)phenyl]-[(1S,8R)-5-(5-fluoro-2-pyridinyl)-3,4,6,12-tetrazatricyclo[6.3.1.02,6]dodeca-2,4-dien-12-yl]methanone (PubChem CID 90413841) has the molecular formula C21H16ClF4N5O and a molecular weight of 465.84 g/mol. Its IUPAC name is [2-chloro-3-(trifluoromethyl)phenyl]-[(1S,8R)-5-(5-fluoro-2-pyridinyl)-3,4,6,12-tetrazatricyclo[6.3.1.02,6]dodeca-2,4-dien-12-yl]methanone.
| Compound Name | [2-chloro-3-(trifluoromethyl)phenyl]-[(1S,8R)-5-(5-fluoro-2-pyridinyl)-3,4,6,12-tetrazatricyclo[6.3.1.02,6]dodeca-2,4-dien-12-yl]methanone |
|---|---|
| PubChem CID | 90413841 |
| Molecular Formula | C21H16ClF4N5O |
| Molecular Weight | 465.84 g/mol |
| Exact Mass | 465.10 |
| IUPAC Name | [2-chloro-3-(trifluoromethyl)phenyl]-[(1S,8R)-5-(5-fluoro-2-pyridinyl)-3,4,6,12-tetrazatricyclo[6.3.1.02,6]dodeca-2,4-dien-12-yl]methanone |
| SMILES | O=C(c1cccc(C(F)(F)F)c1Cl)N1[C@@H]2CCC[C@H]1c1nnc(-c3ccc(F)cn3)n1C2 |
| InChI | InChI=1S/C21H16ClF4N5O/c22-17-13(4-2-5-14(17)21(24,25)26)20(32)31-12-3-1-6-16(31)19-29-28-18(30(19)10-12)15-8-7-11(23)9-27-15/h2,4-5,7-9,12,16H,1,3,6,10H2/t12-,16+/m1/s1 |
| InChIKey | KAXAHUBBXCYPAA-WBMJQRKESA-N |
| XLogP | 4.90 |
| TPSA | 63.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.84 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |