C22H24F2N4O2 — CID 90413900
tert-butyl 3-[4-(2,5-difluoro-4-pyridinyl)-1H-pyrrolo[2,3-b]pyridin-2-yl]piperidine-1-carboxylate (PubChem CID 90413900) has the molecular formula C22H24F2N4O2 and a molecular weight of 414.46 g/mol. Its IUPAC name is tert-butyl 3-[4-(2,5-difluoro-4-pyridinyl)-1H-pyrrolo[2,3-b]pyridin-2-yl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 3-[4-(2,5-difluoro-4-pyridinyl)-1H-pyrrolo[2,3-b]pyridin-2-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 90413900 |
| Molecular Formula | C22H24F2N4O2 |
| Molecular Weight | 414.46 g/mol |
| Exact Mass | 414.19 |
| IUPAC Name | tert-butyl 3-[4-(2,5-difluoro-4-pyridinyl)-1H-pyrrolo[2,3-b]pyridin-2-yl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCC(c2cc3c(-c4cc(F)ncc4F)ccnc3[nH]2)C1 |
| InChI | InChI=1S/C22H24F2N4O2/c1-22(2,3)30-21(29)28-8-4-5-13(12-28)18-9-16-14(6-7-25-20(16)27-18)15-10-19(24)26-11-17(15)23/h6-7,9-11,13H,4-5,8,12H2,1-3H3,(H,25,27) |
| InChIKey | SWOYJKQMLSKIAW-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.46 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|