C26H28FN3O3 — CID 90413998
tert-butyl (3aS,6aR)-5-[4-(5-fluoro-2-methoxyphenyl)-1H-pyrrolo[2,3-b]pyridin-2-yl]-3,3a,6,6a-tetrahydro-1H-cyclopenta[c]pyrrole-2-carboxylate (PubChem CID 90413998) has the molecular formula C26H28FN3O3 and a molecular weight of 449.53 g/mol. Its IUPAC name is tert-butyl (3aS,6aR)-5-[4-(5-fluoro-2-methoxyphenyl)-1H-pyrrolo[2,3-b]pyridin-2-yl]-3,3a,6,6a-tetrahydro-1H-cyclopenta[c]pyrrole-2-carboxylate.
| Compound Name | tert-butyl (3aS,6aR)-5-[4-(5-fluoro-2-methoxyphenyl)-1H-pyrrolo[2,3-b]pyridin-2-yl]-3,3a,6,6a-tetrahydro-1H-cyclopenta[c]pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 90413998 |
| Molecular Formula | C26H28FN3O3 |
| Molecular Weight | 449.53 g/mol |
| Exact Mass | 449.21 |
| IUPAC Name | tert-butyl (3aS,6aR)-5-[4-(5-fluoro-2-methoxyphenyl)-1H-pyrrolo[2,3-b]pyridin-2-yl]-3,3a,6,6a-tetrahydro-1H-cyclopenta[c]pyrrole-2-carboxylate |
| SMILES | COc1ccc(F)cc1-c1ccnc2[nH]c(C3=C[C@@H]4CN(C(=O)OC(C)(C)C)C[C@@H]4C3)cc12 |
| InChI | InChI=1S/C26H28FN3O3/c1-26(2,3)33-25(31)30-13-16-9-15(10-17(16)14-30)22-12-21-19(7-8-28-24(21)29-22)20-11-18(27)5-6-23(20)32-4/h5-9,11-12,16-17H,10,13-14H2,1-4H3,(H,28,29)/t16-,17+/m1/s1 |
| InChIKey | OBAKWNXEBRBTJX-SJORKVTESA-N |
| XLogP | 5.65 |
| TPSA | 67.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.53 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |