C36H38N4O3 — CID 90414199
cis-(1S,2R)-2-[1-[(4-piperidin-1-ylphenyl)methyl]-5-(quinolin-2-ylmethoxy)benzimidazol-2-yl]cyclohexane-1-carboxylic acid (PubChem CID 90414199) has the molecular formula C36H38N4O3 and a molecular weight of 574.73 g/mol. Its IUPAC name is cis-(1S,2R)-2-[1-[(4-piperidin-1-ylphenyl)methyl]-5-(quinolin-2-ylmethoxy)benzimidazol-2-yl]cyclohexane-1-carboxylic acid.
| Compound Name | cis-(1S,2R)-2-[1-[(4-piperidin-1-ylphenyl)methyl]-5-(quinolin-2-ylmethoxy)benzimidazol-2-yl]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 90414199 |
| Molecular Formula | C36H38N4O3 |
| Molecular Weight | 574.73 g/mol |
| Exact Mass | 574.29 |
| IUPAC Name | cis-(1S,2R)-2-[1-[(4-piperidin-1-ylphenyl)methyl]-5-(quinolin-2-ylmethoxy)benzimidazol-2-yl]cyclohexane-1-carboxylic acid |
| SMILES | O=C(O)[C@H]1CCCC[C@H]1c1nc2cc(OCc3ccc4ccccc4n3)ccc2n1Cc1ccc(N2CCCCC2)cc1 |
| InChI | InChI=1S/C36H38N4O3/c41-36(42)31-10-4-3-9-30(31)35-38-33-22-29(43-24-27-15-14-26-8-2-5-11-32(26)37-27)18-19-34(33)40(35)23-25-12-16-28(17-13-25)39-20-6-1-7-21-39/h2,5,8,11-19,22,30-31H,1,3-4,6-7,9-10,20-21,23-24H2,(H,41,42)/t30-,31+/m1/s1 |
| InChIKey | CLSKCGKEBYCJSA-JSOSNVBQSA-N |
| XLogP | 7.56 |
| TPSA | 80.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.73 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|