About 2-methylsulfonyl-5,5-dioxo-5λ6-thia-2-azaspiro[3.4]octane-8-carboxylic acid
2-methylsulfonyl-5,5-dioxo-5λ6-thia-2-azaspiro[3.4]octane-8-carboxylic acid (PubChem CID 90414367) has the molecular formula C8H13NO6S2
and a molecular weight of 283.33 g/mol. Its IUPAC name is 2-methylsulfonyl-5,5-dioxo-5λ6-thia-2-azaspiro[3.4]octane-8-carboxylic acid.
Molecular Properties
| Compound Name | 2-methylsulfonyl-5,5-dioxo-5λ6-thia-2-azaspiro[3.4]octane-8-carboxylic acid |
| PubChem CID | 90414367 |
| Molecular Formula | C8H13NO6S2 |
| Molecular Weight | 283.33 g/mol |
| Exact Mass | 283.02 |
| IUPAC Name | 2-methylsulfonyl-5,5-dioxo-5λ6-thia-2-azaspiro[3.4]octane-8-carboxylic acid |
| SMILES | CS(=O)(=O)N1CC2(C1)C(C(=O)O)CCS2(=O)=O |
| InChI | InChI=1S/C8H13NO6S2/c1-16(12,13)9-4-8(5-9)6(7(10)11)2-3-17(8,14)15/h6H,2-5H2,1H3,(H,10,11) |
| InChIKey | OEBMTHMOYJGNNO-UHFFFAOYSA-N |
| XLogP | -1.48 |
| TPSA | 108.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.33 |
| LogP ≤ 5 | -1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-methylsulfonyl-5,5-dioxo-5λ6-thia-2-azaspiro[3.4]octane-8-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylsulfonyl-5,5-dioxo-5λ6-thia-2-azaspiro[3.4]octane-8-carboxylic acid?
The IUPAC name of 2-methylsulfonyl-5,5-dioxo-5λ6-thia-2-azaspiro[3.4]octane-8-carboxylic acid (CID 90414367) is 2-methylsulfonyl-5,5-dioxo-5λ6-thia-2-azaspiro[3.4]octane-8-carboxylic acid.
What is the SMILES notation for 2-methylsulfonyl-5,5-dioxo-5λ6-thia-2-azaspiro[3.4]octane-8-carboxylic acid?
The canonical SMILES for 2-methylsulfonyl-5,5-dioxo-5λ6-thia-2-azaspiro[3.4]octane-8-carboxylic acid is CS(=O)(=O)N1CC2(C1)C(C(=O)O)CCS2(=O)=O.
What is the InChIKey of 2-methylsulfonyl-5,5-dioxo-5λ6-thia-2-azaspiro[3.4]octane-8-carboxylic acid?
The InChIKey is OEBMTHMOYJGNNO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13NO6S2/c1-16(12,13)9-4-8(5-9)6(7(10)11)2-3-17(8,14)15/h6H,2-5H2,1H3,(H,10,11).
What are the key properties of 2-methylsulfonyl-5,5-dioxo-5λ6-thia-2-azaspiro[3.4]octane-8-carboxylic acid?
2-methylsulfonyl-5,5-dioxo-5λ6-thia-2-azaspiro[3.4]octane-8-carboxylic acid has a molecular weight of 283.33 g/mol, XLogP of -1.48, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylsulfonyl-5,5-dioxo-5λ6-thia-2-azaspiro[3.4]octane-8-carboxylic acid is sourced from PubChem (CID 90414367), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).