C20H18N2O — CID 90414431
2-methyl-5-[3-[(E)-2-phenylethenyl]phenyl]-1H-pyrrole-3-carboxamide (PubChem CID 90414431) has the molecular formula C20H18N2O and a molecular weight of 302.38 g/mol. Its IUPAC name is 2-methyl-5-[3-[(E)-2-phenylethenyl]phenyl]-1H-pyrrole-3-carboxamide.
| Compound Name | 2-methyl-5-[3-[(E)-2-phenylethenyl]phenyl]-1H-pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 90414431 |
| Molecular Formula | C20H18N2O |
| Molecular Weight | 302.38 g/mol |
| Exact Mass | 302.14 |
| IUPAC Name | 2-methyl-5-[3-[(E)-2-phenylethenyl]phenyl]-1H-pyrrole-3-carboxamide |
| SMILES | Cc1[nH]c(-c2cccc(/C=C/c3ccccc3)c2)cc1C(N)=O |
| InChI | InChI=1S/C20H18N2O/c1-14-18(20(21)23)13-19(22-14)17-9-5-8-16(12-17)11-10-15-6-3-2-4-7-15/h2-13,22H,1H3,(H2,21,23)/b11-10+ |
| InChIKey | UWVNUANYVSDMIK-ZHACJKMWSA-N |
| XLogP | 4.26 |
| TPSA | 58.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.38 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|