C22H19ClF3N5O2 — CID 90414706
[2-chloro-3-(trifluoromethyl)phenyl]-[(1R,8S)-5-(4-methoxy-2-pyridinyl)-3,4,6,12-tetrazatricyclo[6.3.1.02,6]dodeca-2,4-dien-12-yl]methanone (PubChem CID 90414706) has the molecular formula C22H19ClF3N5O2 and a molecular weight of 477.87 g/mol. Its IUPAC name is [2-chloro-3-(trifluoromethyl)phenyl]-[(1R,8S)-5-(4-methoxy-2-pyridinyl)-3,4,6,12-tetrazatricyclo[6.3.1.02,6]dodeca-2,4-dien-12-yl]methanone.
| Compound Name | [2-chloro-3-(trifluoromethyl)phenyl]-[(1R,8S)-5-(4-methoxy-2-pyridinyl)-3,4,6,12-tetrazatricyclo[6.3.1.02,6]dodeca-2,4-dien-12-yl]methanone |
|---|---|
| PubChem CID | 90414706 |
| Molecular Formula | C22H19ClF3N5O2 |
| Molecular Weight | 477.87 g/mol |
| Exact Mass | 477.12 |
| IUPAC Name | [2-chloro-3-(trifluoromethyl)phenyl]-[(1R,8S)-5-(4-methoxy-2-pyridinyl)-3,4,6,12-tetrazatricyclo[6.3.1.02,6]dodeca-2,4-dien-12-yl]methanone |
| SMILES | COc1ccnc(-c2nnc3n2C[C@@H]2CCC[C@H]3N2C(=O)c2cccc(C(F)(F)F)c2Cl)c1 |
| InChI | InChI=1S/C22H19ClF3N5O2/c1-33-13-8-9-27-16(10-13)19-28-29-20-17-7-2-4-12(11-30(19)20)31(17)21(32)14-5-3-6-15(18(14)23)22(24,25)26/h3,5-6,8-10,12,17H,2,4,7,11H2,1H3/t12-,17+/m0/s1 |
| InChIKey | SDWUWEKAOFIYDK-YVEFUNNKSA-N |
| XLogP | 4.77 |
| TPSA | 73.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.87 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |