C31H46O7 — CID 90415009
benzoic acid;4-ethyl-2,2,6,6-tetramethylheptane-3,5-diol;2-oxo-2-(2,4,6-trimethylphenyl)acetic acid (PubChem CID 90415009) has the molecular formula C31H46O7 and a molecular weight of 530.70 g/mol. Its IUPAC name is benzoic acid;4-ethyl-2,2,6,6-tetramethylheptane-3,5-diol;2-oxo-2-(2,4,6-trimethylphenyl)acetic acid.
| Compound Name | benzoic acid;4-ethyl-2,2,6,6-tetramethylheptane-3,5-diol;2-oxo-2-(2,4,6-trimethylphenyl)acetic acid |
|---|---|
| PubChem CID | 90415009 |
| Molecular Formula | C31H46O7 |
| Molecular Weight | 530.70 g/mol |
| Exact Mass | 530.32 |
| IUPAC Name | benzoic acid;4-ethyl-2,2,6,6-tetramethylheptane-3,5-diol;2-oxo-2-(2,4,6-trimethylphenyl)acetic acid |
| SMILES | CCC(C(O)C(C)(C)C)C(O)C(C)(C)C.Cc1cc(C)c(C(=O)C(=O)O)c(C)c1.O=C(O)c1ccccc1 |
| InChI | InChI=1S/C13H28O2.C11H12O3.C7H6O2/c1-8-9(10(14)12(2,3)4)11(15)13(5,6)7;1-6-4-7(2)9(8(3)5-6)10(12)11(13)14;8-7(9)6-4-2-1-3-5-6/h9-11,14-15H,8H2,1-7H3;4-5H,1-3H3,(H,13,14);1-5H,(H,8,9) |
| InChIKey | YFEMGZFXUIERIX-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 132.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.70 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|