4-octan-4-yloxy-2,3,4-trioxobutanoic acid

C12H18O6 — CID 90415246

IUPAC4-octan-4-yloxy-2,3,4-trioxobutanoic acid
SMILESCCCCC(CCC)OC(=O)C(=O)C(=O)C(=O)O
InChIInChI=1S/C12H18O6/c1-3-5-7-8(6-4-2)18-12(17)10(14)9(13)11(15)16/h8H,3-7H2,1-2H3,(H,15,16)
InChIKeyQDVLWYXASJLXNM-UHFFFAOYSA-N
MW258.27 g/mol
LogP1.11
Rot. Bonds9

About 4-octan-4-yloxy-2,3,4-trioxobutanoic acid

4-octan-4-yloxy-2,3,4-trioxobutanoic acid (PubChem CID 90415246) has the molecular formula C12H18O6 and a molecular weight of 258.27 g/mol. Its IUPAC name is 4-octan-4-yloxy-2,3,4-trioxobutanoic acid.

Molecular Properties

Compound Name4-octan-4-yloxy-2,3,4-trioxobutanoic acid
PubChem CID90415246
Molecular FormulaC12H18O6
Molecular Weight258.27 g/mol
Exact Mass258.11
IUPAC Name4-octan-4-yloxy-2,3,4-trioxobutanoic acid
SMILESCCCCC(CCC)OC(=O)C(=O)C(=O)C(=O)O
InChIInChI=1S/C12H18O6/c1-3-5-7-8(6-4-2)18-12(17)10(14)9(13)11(15)16/h8H,3-7H2,1-2H3,(H,15,16)
InChIKeyQDVLWYXASJLXNM-UHFFFAOYSA-N
XLogP1.11
TPSA97.74 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds9
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500258.27
LogP ≤ 51.11
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}

Analyze 4-octan-4-yloxy-2,3,4-trioxobutanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-octan-4-yloxy-2,3,4-trioxobutanoic acid?
The IUPAC name of 4-octan-4-yloxy-2,3,4-trioxobutanoic acid (CID 90415246) is 4-octan-4-yloxy-2,3,4-trioxobutanoic acid.
What is the SMILES notation for 4-octan-4-yloxy-2,3,4-trioxobutanoic acid?
The canonical SMILES for 4-octan-4-yloxy-2,3,4-trioxobutanoic acid is CCCCC(CCC)OC(=O)C(=O)C(=O)C(=O)O.
What is the InChIKey of 4-octan-4-yloxy-2,3,4-trioxobutanoic acid?
The InChIKey is QDVLWYXASJLXNM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18O6/c1-3-5-7-8(6-4-2)18-12(17)10(14)9(13)11(15)16/h8H,3-7H2,1-2H3,(H,15,16).
What are the key properties of 4-octan-4-yloxy-2,3,4-trioxobutanoic acid?
4-octan-4-yloxy-2,3,4-trioxobutanoic acid has a molecular weight of 258.27 g/mol, XLogP of 1.11, 9 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-octan-4-yloxy-2,3,4-trioxobutanoic acid is sourced from PubChem (CID 90415246), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).